C19H32N2O2S — CID 110403434
1-(2-methylphenyl)-N-(4-methyl-2-piperidin-1-ylpentyl)methanesulfonamide (PubChem CID 110403434) has the molecular formula C19H32N2O2S and a molecular weight of 352.54 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-(4-methyl-2-piperidin-1-ylpentyl)methanesulfonamide.
| Compound Name | 1-(2-methylphenyl)-N-(4-methyl-2-piperidin-1-ylpentyl)methanesulfonamide |
|---|---|
| PubChem CID | 110403434 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-(2-methylphenyl)-N-(4-methyl-2-piperidin-1-ylpentyl)methanesulfonamide |
| SMILES | Cc1ccccc1CS(=O)(=O)NCC(CC(C)C)N1CCCCC1 |
| InChI | InChI=1S/C19H32N2O2S/c1-16(2)13-19(21-11-7-4-8-12-21)14-20-24(22,23)15-18-10-6-5-9-17(18)3/h5-6,9-10,16,19-20H,4,7-8,11-15H2,1-3H3 |
| InChIKey | KUYNHLGZHKKFLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |