C17H27N — CID 176959434
1-[1-(2-methylphenyl)pentan-2-yl]piperidine (PubChem CID 176959434) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1-[1-(2-methylphenyl)pentan-2-yl]piperidine.
| Compound Name | 1-[1-(2-methylphenyl)pentan-2-yl]piperidine |
|---|---|
| PubChem CID | 176959434 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1-[1-(2-methylphenyl)pentan-2-yl]piperidine |
| SMILES | CCCC(Cc1ccccc1C)N1CCCCC1 |
| InChI | InChI=1S/C17H27N/c1-3-9-17(18-12-7-4-8-13-18)14-16-11-6-5-10-15(16)2/h5-6,10-11,17H,3-4,7-9,12-14H2,1-2H3 |
| InChIKey | YYKHEWYMDPTHSA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |