C23H38N2O — CID 144994804
N-ethylbut-1-en-2-amine;2-[(2-methylphenyl)methyl]-1-piperidin-1-ylbutan-1-one (PubChem CID 144994804) has the molecular formula C23H38N2O and a molecular weight of 358.57 g/mol. Its IUPAC name is N-ethylbut-1-en-2-amine;2-[(2-methylphenyl)methyl]-1-piperidin-1-ylbutan-1-one.
| Compound Name | N-ethylbut-1-en-2-amine;2-[(2-methylphenyl)methyl]-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 144994804 |
| Molecular Formula | C23H38N2O |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.30 |
| IUPAC Name | N-ethylbut-1-en-2-amine;2-[(2-methylphenyl)methyl]-1-piperidin-1-ylbutan-1-one |
| SMILES | C=C(CC)NCC.CCC(Cc1ccccc1C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H25NO.C6H13N/c1-3-15(13-16-10-6-5-9-14(16)2)17(19)18-11-7-4-8-12-18;1-4-6(3)7-5-2/h5-6,9-10,15H,3-4,7-8,11-13H2,1-2H3;7H,3-5H2,1-2H3 |
| InChIKey | NJPZOVJWGYURAA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |