C17H24N4O3S — CID 110405040
3,5-dimethyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 110405040) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 110405040 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3,5-dimethyl-N-[2-(4-morpholin-4-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H24N4O3S/c1-13-17(14(2)20-19-13)25(22,23)18-8-7-15-3-5-16(6-4-15)21-9-11-24-12-10-21/h3-6,18H,7-12H2,1-2H3,(H,19,20) |
| InChIKey | ZKFLMIHXPAXNEF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|