C19H20N2O3 — CID 110405900
N-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-4-phenoxybutanamide (PubChem CID 110405900) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-4-phenoxybutanamide.
| Compound Name | N-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110405900 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-4-phenoxybutanamide |
| SMILES | CC1C(=O)Nc2ccc(NC(=O)CCCOc3ccccc3)cc21 |
| InChI | InChI=1S/C19H20N2O3/c1-13-16-12-14(9-10-17(16)21-19(13)23)20-18(22)8-5-11-24-15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HNAGVHPQOWWURW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|