C16H15N3O2 — CID 110405906
1-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-phenylurea (PubChem CID 110405906) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-phenylurea.
| Compound Name | 1-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-phenylurea |
|---|---|
| PubChem CID | 110405906 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-phenylurea |
| SMILES | CC1C(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc21 |
| InChI | InChI=1S/C16H15N3O2/c1-10-13-9-12(7-8-14(13)19-15(10)20)18-16(21)17-11-5-3-2-4-6-11/h2-10H,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | LEGDCONOPXTMMF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |