About quinolin-8-yl 3-bromo-4-ethoxybenzoate
quinolin-8-yl 3-bromo-4-ethoxybenzoate (PubChem CID 1104066) has the molecular formula C18H14BrNO3
and a molecular weight of 372.22 g/mol. Its IUPAC name is quinolin-8-yl 3-bromo-4-ethoxybenzoate.
Molecular Properties
| Compound Name | quinolin-8-yl 3-bromo-4-ethoxybenzoate |
| PubChem CID | 1104066 |
| Molecular Formula | C18H14BrNO3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | quinolin-8-yl 3-bromo-4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2cccc3cccnc23)cc1Br |
| InChI | InChI=1S/C18H14BrNO3/c1-2-22-15-9-8-13(11-14(15)19)18(21)23-16-7-3-5-12-6-4-10-20-17(12)16/h3-11H,2H2,1H3 |
| InChIKey | AJFJSQGHQHYUBJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl 3-bromo-4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl 3-bromo-4-ethoxybenzoate?
The IUPAC name of quinolin-8-yl 3-bromo-4-ethoxybenzoate (CID 1104066) is quinolin-8-yl 3-bromo-4-ethoxybenzoate.
What is the SMILES notation for quinolin-8-yl 3-bromo-4-ethoxybenzoate?
The canonical SMILES for quinolin-8-yl 3-bromo-4-ethoxybenzoate is CCOc1ccc(C(=O)Oc2cccc3cccnc23)cc1Br.
What is the InChIKey of quinolin-8-yl 3-bromo-4-ethoxybenzoate?
The InChIKey is AJFJSQGHQHYUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrNO3/c1-2-22-15-9-8-13(11-14(15)19)18(21)23-16-7-3-5-12-6-4-10-20-17(12)16/h3-11H,2H2,1H3.
What are the key properties of quinolin-8-yl 3-bromo-4-ethoxybenzoate?
quinolin-8-yl 3-bromo-4-ethoxybenzoate has a molecular weight of 372.22 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl 3-bromo-4-ethoxybenzoate is sourced from PubChem (CID 1104066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).