About (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate
(2-acetamidophenyl) 3-bromo-4-ethoxybenzoate (PubChem CID 23013408) has the molecular formula C17H16BrNO4
and a molecular weight of 378.22 g/mol. Its IUPAC name is (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate.
Molecular Properties
| Compound Name | (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate |
| PubChem CID | 23013408 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccccc2NC(C)=O)cc1Br |
| InChI | InChI=1S/C17H16BrNO4/c1-3-22-15-9-8-12(10-13(15)18)17(21)23-16-7-5-4-6-14(16)19-11(2)20/h4-10H,3H2,1-2H3,(H,19,20) |
| InChIKey | NDHJXRKIJARAGA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate?
The IUPAC name of (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate (CID 23013408) is (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate.
What is the SMILES notation for (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate?
The canonical SMILES for (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate is CCOc1ccc(C(=O)Oc2ccccc2NC(C)=O)cc1Br.
What is the InChIKey of (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate?
The InChIKey is NDHJXRKIJARAGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrNO4/c1-3-22-15-9-8-12(10-13(15)18)17(21)23-16-7-5-4-6-14(16)19-11(2)20/h4-10H,3H2,1-2H3,(H,19,20).
What are the key properties of (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate?
(2-acetamidophenyl) 3-bromo-4-ethoxybenzoate has a molecular weight of 378.22 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidophenyl) 3-bromo-4-ethoxybenzoate is sourced from PubChem (CID 23013408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).