C15H15BrN2O3S — CID 110408216
2-bromo-N-[2-(phenylsulfamoyl)ethyl]benzamide (PubChem CID 110408216) has the molecular formula C15H15BrN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 2-bromo-N-[2-(phenylsulfamoyl)ethyl]benzamide.
| Compound Name | 2-bromo-N-[2-(phenylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 110408216 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-bromo-N-[2-(phenylsulfamoyl)ethyl]benzamide |
| SMILES | O=C(NCCS(=O)(=O)Nc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C15H15BrN2O3S/c16-14-9-5-4-8-13(14)15(19)17-10-11-22(20,21)18-12-6-2-1-3-7-12/h1-9,18H,10-11H2,(H,17,19) |
| InChIKey | OBPHEQGJXHPSDE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |