C20H21N3O4S — CID 110615725
6,8-dimethyl-2-oxo-N-[2-(phenylsulfamoyl)ethyl]-1H-quinoline-3-carboxamide (PubChem CID 110615725) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 6,8-dimethyl-2-oxo-N-[2-(phenylsulfamoyl)ethyl]-1H-quinoline-3-carboxamide.
| Compound Name | 6,8-dimethyl-2-oxo-N-[2-(phenylsulfamoyl)ethyl]-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110615725 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 6,8-dimethyl-2-oxo-N-[2-(phenylsulfamoyl)ethyl]-1H-quinoline-3-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(C(=O)NCCS(=O)(=O)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C20H21N3O4S/c1-13-10-14(2)18-15(11-13)12-17(20(25)22-18)19(24)21-8-9-28(26,27)23-16-6-4-3-5-7-16/h3-7,10-12,23H,8-9H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | IDBJQFPEZARADT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |