C16H19ClN2O4S — CID 110409851
1-[3-(3-chloro-4-methoxyphenyl)sulfonylpropanoyl]piperidine-4-carbonitrile (PubChem CID 110409851) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-methoxyphenyl)sulfonylpropanoyl]piperidine-4-carbonitrile.
| Compound Name | 1-[3-(3-chloro-4-methoxyphenyl)sulfonylpropanoyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 110409851 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-[3-(3-chloro-4-methoxyphenyl)sulfonylpropanoyl]piperidine-4-carbonitrile |
| SMILES | COc1ccc(S(=O)(=O)CCC(=O)N2CCC(C#N)CC2)cc1Cl |
| InChI | InChI=1S/C16H19ClN2O4S/c1-23-15-3-2-13(10-14(15)17)24(21,22)9-6-16(20)19-7-4-12(11-18)5-8-19/h2-3,10,12H,4-9H2,1H3 |
| InChIKey | YJCIGKWMFQRCBJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |