C16H22ClNO5S — CID 110626467
3-(3-chloro-4-methoxyphenyl)sulfonyl-N-[(1-hydroxycyclopentyl)methyl]propanamide (PubChem CID 110626467) has the molecular formula C16H22ClNO5S and a molecular weight of 375.87 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)sulfonyl-N-[(1-hydroxycyclopentyl)methyl]propanamide.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)sulfonyl-N-[(1-hydroxycyclopentyl)methyl]propanamide |
|---|---|
| PubChem CID | 110626467 |
| Molecular Formula | C16H22ClNO5S |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)sulfonyl-N-[(1-hydroxycyclopentyl)methyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)CCC(=O)NCC2(O)CCCC2)cc1Cl |
| InChI | InChI=1S/C16H22ClNO5S/c1-23-14-5-4-12(10-13(14)17)24(21,22)9-6-15(19)18-11-16(20)7-2-3-8-16/h4-5,10,20H,2-3,6-9,11H2,1H3,(H,18,19) |
| InChIKey | VJFLSZJEEZOYGT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |