C12H16 — CID 11041001
(1S,2R,7S,8R)-tricyclo[6.2.2.02,7]dodeca-3,9-diene (PubChem CID 11041001) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (1S,2R,7S,8R)-tricyclo[6.2.2.02,7]dodeca-3,9-diene.
| Compound Name | (1S,2R,7S,8R)-tricyclo[6.2.2.02,7]dodeca-3,9-diene |
|---|---|
| PubChem CID | 11041001 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (1S,2R,7S,8R)-tricyclo[6.2.2.02,7]dodeca-3,9-diene |
| SMILES | C1=C[C@H]2[C@@H](CC1)[C@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C12H16/c1-2-4-12-10-7-5-9(6-8-10)11(12)3-1/h1,3,5,7,9-12H,2,4,6,8H2/t9-,10+,11-,12+/m1/s1 |
| InChIKey | OPOFYMSEXICFOW-KXNHARMFSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|