C17H15N3O3 — CID 110410091
N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 110410091) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 110410091 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | c1ccc(-c2nnc(CNc3ccc4c(c3)OCCO4)o2)cc1 |
| InChI | InChI=1S/C17H15N3O3/c1-2-4-12(5-3-1)17-20-19-16(23-17)11-18-13-6-7-14-15(10-13)22-9-8-21-14/h1-7,10,18H,8-9,11H2 |
| InChIKey | CYHWXUUVBUWZPY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|