C14H12N4O — CID 5122987
N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]pyridin-4-amine (PubChem CID 5122987) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]pyridin-4-amine.
| Compound Name | N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 5122987 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]pyridin-4-amine |
| SMILES | c1ccc(-c2nnc(CNc3ccncc3)o2)cc1 |
| InChI | InChI=1S/C14H12N4O/c1-2-4-11(5-3-1)14-18-17-13(19-14)10-16-12-6-8-15-9-7-12/h1-9H,10H2,(H,15,16) |
| InChIKey | ZSXCNARXYGWRIU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |