C16H17ClN2O4S — CID 110412691
5-chloro-2-methoxy-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)benzenesulfonamide (PubChem CID 110412691) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110412691 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 5-chloro-2-methoxy-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCN2C |
| InChI | InChI=1S/C16H17ClN2O4S/c1-19-7-8-23-15-10-12(4-5-13(15)19)18-24(20,21)16-9-11(17)3-6-14(16)22-2/h3-6,9-10,18H,7-8H2,1-2H3 |
| InChIKey | QJGCURQMFORDTR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|