C9H13NO3 — CID 11041382
5-amino-2,4-dimethoxy-3-methylphenol (PubChem CID 11041382) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-3-methylphenol.
| Compound Name | 5-amino-2,4-dimethoxy-3-methylphenol |
|---|---|
| PubChem CID | 11041382 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-amino-2,4-dimethoxy-3-methylphenol |
| SMILES | COc1c(N)cc(O)c(OC)c1C |
| InChI | InChI=1S/C9H13NO3/c1-5-8(12-2)6(10)4-7(11)9(5)13-3/h4,11H,10H2,1-3H3 |
| InChIKey | YRDPMUIJYTVWLI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|