C18H29N3O — CID 110414411
3-[[1-(3,4-dimethylphenyl)pyrrolidin-3-yl]methyl]-1,1-diethylurea (PubChem CID 110414411) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-[[1-(3,4-dimethylphenyl)pyrrolidin-3-yl]methyl]-1,1-diethylurea.
| Compound Name | 3-[[1-(3,4-dimethylphenyl)pyrrolidin-3-yl]methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 110414411 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 3-[[1-(3,4-dimethylphenyl)pyrrolidin-3-yl]methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC1CCN(c2ccc(C)c(C)c2)C1 |
| InChI | InChI=1S/C18H29N3O/c1-5-20(6-2)18(22)19-12-16-9-10-21(13-16)17-8-7-14(3)15(4)11-17/h7-8,11,16H,5-6,9-10,12-13H2,1-4H3,(H,19,22) |
| InChIKey | SBCNAHGCSQGTJT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|