C21H20N4O2 — CID 110414581
3-[(E)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]-1H-quinolin-2-one (PubChem CID 110414581) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-[(E)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]-1H-quinolin-2-one.
| Compound Name | 3-[(E)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 110414581 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[(E)-3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)prop-1-enyl]-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1cc2ccccc2[nH]c1=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H20N4O2/c26-20(25-13-11-24(12-14-25)19-7-3-4-10-22-19)9-8-17-15-16-5-1-2-6-18(16)23-21(17)27/h1-10,15H,11-14H2,(H,23,27)/b9-8+ |
| InChIKey | BWOZDDZEQOVIEN-CMDGGOBGSA-N |
| XLogP | 2.29 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|