C23H26N2O2 — CID 110414901
4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-phenylpentanamide (PubChem CID 110414901) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-phenylpentanamide.
| Compound Name | 4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-phenylpentanamide |
|---|---|
| PubChem CID | 110414901 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-phenylpentanamide |
| SMILES | Cc1ccc2[nH]c(=O)c(CNC(=O)CCC(C)(C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-16-9-10-20-17(13-16)14-18(22(27)25-20)15-24-21(26)11-12-23(2,3)19-7-5-4-6-8-19/h4-10,13-14H,11-12,15H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | XNIOCGHUZWHSPZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |