C20H19FN2O2 — CID 110414954
3-(3-fluorophenyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide (PubChem CID 110414954) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide.
| Compound Name | 3-(3-fluorophenyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110414954 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide |
| SMILES | Cc1ccc2[nH]c(=O)c(CNC(=O)CCc3cccc(F)c3)cc2c1 |
| InChI | InChI=1S/C20H19FN2O2/c1-13-5-7-18-15(9-13)11-16(20(25)23-18)12-22-19(24)8-6-14-3-2-4-17(21)10-14/h2-5,7,9-11H,6,8,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | QPPVINZRZUXYPL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |