C16H26N2O2 — CID 110415381
3-tert-butyl-N-cycloheptyl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 110415381) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-tert-butyl-N-cycloheptyl-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-tert-butyl-N-cycloheptyl-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110415381 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 3-tert-butyl-N-cycloheptyl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(C(C)(C)C)c1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H26N2O2/c1-11-13(14(18-20-11)16(2,3)4)15(19)17-12-9-7-5-6-8-10-12/h12H,5-10H2,1-4H3,(H,17,19) |
| InChIKey | UPPDWBMCNJREIS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |