C18H21FN4O2 — CID 110417316
(E)-1-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-yl]-3-(2-fluorophenyl)-2-methylprop-2-en-1-one (PubChem CID 110417316) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is (E)-1-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-yl]-3-(2-fluorophenyl)-2-methylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-yl]-3-(2-fluorophenyl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 110417316 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (E)-1-[4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-yl]-3-(2-fluorophenyl)-2-methylprop-2-en-1-one |
| SMILES | CCc1nnc(N2CCN(C(=O)/C(C)=C/c3ccccc3F)CC2)o1 |
| InChI | InChI=1S/C18H21FN4O2/c1-3-16-20-21-18(25-16)23-10-8-22(9-11-23)17(24)13(2)12-14-6-4-5-7-15(14)19/h4-7,12H,3,8-11H2,1-2H3/b13-12+ |
| InChIKey | QLFBTGMHBRTRGJ-OUKQBFOZSA-N |
| XLogP | 2.52 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|