methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate

C10H16N4O3 — CID 110419224

IUPACmethyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate
SMILESCCc1nnc(N2CCN(C(=O)OC)CC2)o1
InChIInChI=1S/C10H16N4O3/c1-3-8-11-12-9(17-8)13-4-6-14(7-5-13)10(15)16-2/h3-7H2,1-2H3
InChIKeyVJLALRYZZVBKCU-UHFFFAOYSA-N
MW240.26 g/mol
LogP0.52
Rot. Bonds2

About methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate

methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate (PubChem CID 110419224) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate
PubChem CID110419224
Molecular FormulaC10H16N4O3
Molecular Weight240.26 g/mol
Exact Mass240.12
IUPAC Namemethyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate
SMILESCCc1nnc(N2CCN(C(=O)OC)CC2)o1
InChIInChI=1S/C10H16N4O3/c1-3-8-11-12-9(17-8)13-4-6-14(7-5-13)10(15)16-2/h3-7H2,1-2H3
InChIKeyVJLALRYZZVBKCU-UHFFFAOYSA-N
XLogP0.52
TPSA71.70 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 50.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate?
The IUPAC name of methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate (CID 110419224) is methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate.
What is the SMILES notation for methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate?
The canonical SMILES for methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate is CCc1nnc(N2CCN(C(=O)OC)CC2)o1.
What is the InChIKey of methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate?
The InChIKey is VJLALRYZZVBKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3/c1-3-8-11-12-9(17-8)13-4-6-14(7-5-13)10(15)16-2/h3-7H2,1-2H3.
What are the key properties of methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate?
methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate has a molecular weight of 240.26 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxylate is sourced from PubChem (CID 110419224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).