C20H30N2O3S — CID 110419524
N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 110419524) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110419524 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cccc(CN2CCCC2C(=O)NCCCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C20H30N2O3S/c1-16-5-2-6-18(13-16)14-22-11-4-8-19(22)20(23)21-10-3-7-17-9-12-26(24,25)15-17/h2,5-6,13,17,19H,3-4,7-12,14-15H2,1H3,(H,21,23) |
| InChIKey | GSIZYBOIDBFNSF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|