C17H25NO2 — CID 80709993
tert-butyl (2R)-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 80709993) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl (2R)-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80709993 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl (2R)-1-[(3-methylphenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | Cc1cccc(CN2CCC[C@@H]2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H25NO2/c1-13-7-5-8-14(11-13)12-18-10-6-9-15(18)16(19)20-17(2,3)4/h5,7-8,11,15H,6,9-10,12H2,1-4H3/t15-/m1/s1 |
| InChIKey | MASOSVMWGRVFCW-OAHLLOKOSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |