C17H25NO3 — CID 80997744
tert-butyl (2S)-1-[(3-methoxyphenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 80997744) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(3-methoxyphenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(3-methoxyphenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80997744 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl (2S)-1-[(3-methoxyphenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COc1cccc(CN2CCC[C@H]2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)21-16(19)15-9-6-10-18(15)12-13-7-5-8-14(11-13)20-4/h5,7-8,11,15H,6,9-10,12H2,1-4H3/t15-/m0/s1 |
| InChIKey | NCVLAINZBUKBNG-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |