C19H29NO2 — CID 110420722
1-[4-(3-ethylphenoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 110420722) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[4-(3-ethylphenoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(3-ethylphenoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110420722 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[4-(3-ethylphenoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CCc1cccc(OC2CCN(C(=O)CC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H29NO2/c1-5-15-7-6-8-17(13-15)22-16-9-11-20(12-10-16)18(21)14-19(2,3)4/h6-8,13,16H,5,9-12,14H2,1-4H3 |
| InChIKey | NUMQSTJSGBMBGJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |