C12H24O2Si — CID 11042504
2-[(4S,6S)-4,6-dimethyl-1,3-dioxan-2-yl]prop-2-enyl-trimethylsilane (PubChem CID 11042504) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is 2-[(4S,6S)-4,6-dimethyl-1,3-dioxan-2-yl]prop-2-enyl-trimethylsilane.
| Compound Name | 2-[(4S,6S)-4,6-dimethyl-1,3-dioxan-2-yl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 11042504 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-[(4S,6S)-4,6-dimethyl-1,3-dioxan-2-yl]prop-2-enyl-trimethylsilane |
| SMILES | C=C(C[Si](C)(C)C)C1O[C@@H](C)C[C@H](C)O1 |
| InChI | InChI=1S/C12H24O2Si/c1-9(8-15(4,5)6)12-13-10(2)7-11(3)14-12/h10-12H,1,7-8H2,2-6H3/t10-,11-/m0/s1 |
| InChIKey | QFRONPKLLORJQH-QWRGUYRKSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|