C15H18Cl2N4O — CID 110429514
2,2-dichloro-N-[[4-(dimethylamino)phenyl]-(1-methylimidazol-2-yl)methyl]acetamide (PubChem CID 110429514) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is 2,2-dichloro-N-[[4-(dimethylamino)phenyl]-(1-methylimidazol-2-yl)methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[[4-(dimethylamino)phenyl]-(1-methylimidazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 110429514 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,2-dichloro-N-[[4-(dimethylamino)phenyl]-(1-methylimidazol-2-yl)methyl]acetamide |
| SMILES | CN(C)c1ccc(C(NC(=O)C(Cl)Cl)c2nccn2C)cc1 |
| InChI | InChI=1S/C15H18Cl2N4O/c1-20(2)11-6-4-10(5-7-11)12(19-15(22)13(16)17)14-18-8-9-21(14)3/h4-9,12-13H,1-3H3,(H,19,22) |
| InChIKey | SLNPOHGIDPAWFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|