C18H29N3O — CID 110429823
3-decyl-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 110429823) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-decyl-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-decyl-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 110429823 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 3-decyl-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCCn1c(C)nc2[nH]c(C)cc2c1=O |
| InChI | InChI=1S/C18H29N3O/c1-4-5-6-7-8-9-10-11-12-21-15(3)20-17-16(18(21)22)13-14(2)19-17/h13,19H,4-12H2,1-3H3 |
| InChIKey | KYDIHBRLGSGUBN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|