C12H17N3O — CID 110429627
6-methyl-3-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 110429627) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 6-methyl-3-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-3-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 110429627 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 6-methyl-3-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCn1cnc2[nH]c(C)cc2c1=O |
| InChI | InChI=1S/C12H17N3O/c1-3-4-5-6-15-8-13-11-10(12(15)16)7-9(2)14-11/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | HESGRIYXGRZMPJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|