C11H16N4O — CID 163346905
1-methyl-5-pentylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 163346905) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-methyl-5-pentylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-methyl-5-pentylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 163346905 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-methyl-5-pentylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCCCn1cnc2c(cnn2C)c1=O |
| InChI | InChI=1S/C11H16N4O/c1-3-4-5-6-15-8-12-10-9(11(15)16)7-13-14(10)2/h7-8H,3-6H2,1-2H3 |
| InChIKey | HGCDFLIJDIXDLL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|