About 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one
5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 63277468) has the molecular formula C10H13BrN4O
and a molecular weight of 285.14 g/mol. Its IUPAC name is 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 63277468 |
| Molecular Formula | C10H13BrN4O |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1ncc2c(=O)n(CCCCBr)cnc21 |
| InChI | InChI=1S/C10H13BrN4O/c1-14-9-8(6-13-14)10(16)15(7-12-9)5-3-2-4-11/h6-7H,2-5H2,1H3 |
| InChIKey | LWSTVZLXZTWOKH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one (CID 63277468) is 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one is Cn1ncc2c(=O)n(CCCCBr)cnc21.
What is the InChIKey of 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is LWSTVZLXZTWOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4O/c1-14-9-8(6-13-14)10(16)15(7-12-9)5-3-2-4-11/h6-7H,2-5H2,1H3.
What are the key properties of 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 285.14 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromobutyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 63277468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).