C12H19N5O — CID 55088277
5-[4-(ethylamino)butyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 55088277) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 5-[4-(ethylamino)butyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[4-(ethylamino)butyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55088277 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 5-[4-(ethylamino)butyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCNCCCCn1cnc2c(cnn2C)c1=O |
| InChI | InChI=1S/C12H19N5O/c1-3-13-6-4-5-7-17-9-14-11-10(12(17)18)8-15-16(11)2/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | CDONACNWLRLNFF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|