C16H17N5O2 — CID 110432166
N-butan-2-yl-6-(3-nitrophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110432166) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is N-butan-2-yl-6-(3-nitrophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butan-2-yl-6-(3-nitrophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110432166 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-butan-2-yl-6-(3-nitrophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(C)Nc1ncnc2[nH]c(-c3cccc([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C16H17N5O2/c1-3-10(2)19-15-13-8-14(20-16(13)18-9-17-15)11-5-4-6-12(7-11)21(22)23/h4-10H,3H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | FVZVASMMOSOARR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|