C14H11ClN4 — CID 110432331
N-[(2-chlorophenyl)methyl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 110432331) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110432331 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1ccccc1CNc1ncnc2ncccc12 |
| InChI | InChI=1S/C14H11ClN4/c15-12-6-2-1-4-10(12)8-17-14-11-5-3-7-16-13(11)18-9-19-14/h1-7,9H,8H2,(H,16,17,18,19) |
| InChIKey | XWSFASNFMAPEHI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |