C15H24O3 — CID 11043244
(2S,3S,5S,6S,8S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2,8-dimethyltricyclo[4.4.0.02,8]decan-7-one (PubChem CID 11043244) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (2S,3S,5S,6S,8S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2,8-dimethyltricyclo[4.4.0.02,8]decan-7-one.
| Compound Name | (2S,3S,5S,6S,8S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2,8-dimethyltricyclo[4.4.0.02,8]decan-7-one |
|---|---|
| PubChem CID | 11043244 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (2S,3S,5S,6S,8S)-3-hydroxy-5-(2-hydroxypropan-2-yl)-2,8-dimethyltricyclo[4.4.0.02,8]decan-7-one |
| SMILES | CC(C)(O)[C@H]1C[C@H](O)C2(C)C3CC[C@]2(C)C(=O)[C@@H]31 |
| InChI | InChI=1S/C15H24O3/c1-13(2,18)9-7-10(16)15(4)8-5-6-14(15,3)12(17)11(8)9/h8-11,16,18H,5-7H2,1-4H3/t8?,9-,10-,11-,14+,15?/m0/s1 |
| InChIKey | AUKRSFWNNGSNMH-BOAWMDNBSA-N |
| XLogP | 1.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |