C17H22N2S — CID 110433974
N,N-dipropyl-1,3-dihydrothieno[3,4-b]quinolin-9-amine (PubChem CID 110433974) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is N,N-dipropyl-1,3-dihydrothieno[3,4-b]quinolin-9-amine.
| Compound Name | N,N-dipropyl-1,3-dihydrothieno[3,4-b]quinolin-9-amine |
|---|---|
| PubChem CID | 110433974 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N,N-dipropyl-1,3-dihydrothieno[3,4-b]quinolin-9-amine |
| SMILES | CCCN(CCC)c1c2c(nc3ccccc13)CSC2 |
| InChI | InChI=1S/C17H22N2S/c1-3-9-19(10-4-2)17-13-7-5-6-8-15(13)18-16-12-20-11-14(16)17/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | FWCJVMMFACPMJE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |