C13H25O3P — CID 11043502
(2E,4E)-1-diethoxyphosphorylnona-2,4-diene (PubChem CID 11043502) has the molecular formula C13H25O3P and a molecular weight of 260.31 g/mol. Its IUPAC name is (2E,4E)-1-diethoxyphosphorylnona-2,4-diene.
| Compound Name | (2E,4E)-1-diethoxyphosphorylnona-2,4-diene |
|---|---|
| PubChem CID | 11043502 |
| Molecular Formula | C13H25O3P |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2E,4E)-1-diethoxyphosphorylnona-2,4-diene |
| SMILES | CCCC/C=C/C=C/CP(=O)(OCC)OCC |
| InChI | InChI=1S/C13H25O3P/c1-4-7-8-9-10-11-12-13-17(14,15-5-2)16-6-3/h9-12H,4-8,13H2,1-3H3/b10-9+,12-11+ |
| InChIKey | KAKGRPXFEPZSGQ-HULFFUFUSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|