C19H17FN2O2 — CID 110435536
2-[6-fluoro-2-methyl-4-(4-methylanilino)quinolin-3-yl]acetic acid (PubChem CID 110435536) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[6-fluoro-2-methyl-4-(4-methylanilino)quinolin-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-2-methyl-4-(4-methylanilino)quinolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 110435536 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[6-fluoro-2-methyl-4-(4-methylanilino)quinolin-3-yl]acetic acid |
| SMILES | Cc1ccc(Nc2c(CC(=O)O)c(C)nc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C19H17FN2O2/c1-11-3-6-14(7-4-11)22-19-15(10-18(23)24)12(2)21-17-8-5-13(20)9-16(17)19/h3-9H,10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | YAQVIWVAYOOCNJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |