C17H19FN2O2 — CID 110432762
2-[4-(cyclopentylamino)-6-fluoro-2-methylquinolin-3-yl]acetic acid (PubChem CID 110432762) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[4-(cyclopentylamino)-6-fluoro-2-methylquinolin-3-yl]acetic acid.
| Compound Name | 2-[4-(cyclopentylamino)-6-fluoro-2-methylquinolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 110432762 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[4-(cyclopentylamino)-6-fluoro-2-methylquinolin-3-yl]acetic acid |
| SMILES | Cc1nc2ccc(F)cc2c(NC2CCCC2)c1CC(=O)O |
| InChI | InChI=1S/C17H19FN2O2/c1-10-13(9-16(21)22)17(20-12-4-2-3-5-12)14-8-11(18)6-7-15(14)19-10/h6-8,12H,2-5,9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | YGMLHFMONKYMNY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |