C20H25FN2O2 — CID 110434107
methyl 2-[4-(2-ethylpiperidin-1-yl)-6-fluoro-2-methylquinolin-3-yl]acetate (PubChem CID 110434107) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is methyl 2-[4-(2-ethylpiperidin-1-yl)-6-fluoro-2-methylquinolin-3-yl]acetate.
| Compound Name | methyl 2-[4-(2-ethylpiperidin-1-yl)-6-fluoro-2-methylquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 110434107 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | methyl 2-[4-(2-ethylpiperidin-1-yl)-6-fluoro-2-methylquinolin-3-yl]acetate |
| SMILES | CCC1CCCCN1c1c(CC(=O)OC)c(C)nc2ccc(F)cc12 |
| InChI | InChI=1S/C20H25FN2O2/c1-4-15-7-5-6-10-23(15)20-16(12-19(24)25-3)13(2)22-18-9-8-14(21)11-17(18)20/h8-9,11,15H,4-7,10,12H2,1-3H3 |
| InChIKey | XVWNQXJNHOQRFS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |