C19H25FN2O2 — CID 110434100
methyl 2-[4-[butyl(ethyl)amino]-6-fluoro-2-methylquinolin-3-yl]acetate (PubChem CID 110434100) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is methyl 2-[4-[butyl(ethyl)amino]-6-fluoro-2-methylquinolin-3-yl]acetate.
| Compound Name | methyl 2-[4-[butyl(ethyl)amino]-6-fluoro-2-methylquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 110434100 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | methyl 2-[4-[butyl(ethyl)amino]-6-fluoro-2-methylquinolin-3-yl]acetate |
| SMILES | CCCCN(CC)c1c(CC(=O)OC)c(C)nc2ccc(F)cc12 |
| InChI | InChI=1S/C19H25FN2O2/c1-5-7-10-22(6-2)19-15(12-18(23)24-4)13(3)21-17-9-8-14(20)11-16(17)19/h8-9,11H,5-7,10,12H2,1-4H3 |
| InChIKey | SLODZWXSEYCVMP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |