C17H20F2N2O2 — CID 123456423
methyl 2-[3-[ethyl(propyl)amino]-5,7-difluoroquinolin-6-yl]acetate (PubChem CID 123456423) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 2-[3-[ethyl(propyl)amino]-5,7-difluoroquinolin-6-yl]acetate.
| Compound Name | methyl 2-[3-[ethyl(propyl)amino]-5,7-difluoroquinolin-6-yl]acetate |
|---|---|
| PubChem CID | 123456423 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 2-[3-[ethyl(propyl)amino]-5,7-difluoroquinolin-6-yl]acetate |
| SMILES | CCCN(CC)c1cnc2cc(F)c(CC(=O)OC)c(F)c2c1 |
| InChI | InChI=1S/C17H20F2N2O2/c1-4-6-21(5-2)11-7-13-15(20-10-11)9-14(18)12(17(13)19)8-16(22)23-3/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | GNZWCNBPFJVLBY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |