C14H13F3N2O2 — CID 79204308
methyl 2-[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]acetate (PubChem CID 79204308) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is methyl 2-[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]acetate.
| Compound Name | methyl 2-[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 79204308 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | methyl 2-[3,5-dimethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]acetate |
| SMILES | COC(=O)Cc1c(C)nn(-c2cc(F)c(F)c(F)c2)c1C |
| InChI | InChI=1S/C14H13F3N2O2/c1-7-10(6-13(20)21-3)8(2)19(18-7)9-4-11(15)14(17)12(16)5-9/h4-5H,6H2,1-3H3 |
| InChIKey | FSUXHGAMXKJMAJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|