C14H15BrN2O2 — CID 61381058
methyl 2-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]acetate (PubChem CID 61381058) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is methyl 2-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]acetate.
| Compound Name | methyl 2-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 61381058 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | methyl 2-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]acetate |
| SMILES | COC(=O)Cc1c(C)nn(-c2ccccc2Br)c1C |
| InChI | InChI=1S/C14H15BrN2O2/c1-9-11(8-14(18)19-3)10(2)17(16-9)13-7-5-4-6-12(13)15/h4-7H,8H2,1-3H3 |
| InChIKey | LJKJQBBEOTXZMX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |