C16H22BrN3 — CID 79225272
3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-ethylpropan-1-amine (PubChem CID 79225272) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-ethylpropan-1-amine.
| Compound Name | 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 79225272 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-[1-(2-bromophenyl)-3,5-dimethylpyrazol-4-yl]-N-ethylpropan-1-amine |
| SMILES | CCNCCCc1c(C)nn(-c2ccccc2Br)c1C |
| InChI | InChI=1S/C16H22BrN3/c1-4-18-11-7-8-14-12(2)19-20(13(14)3)16-10-6-5-9-15(16)17/h5-6,9-10,18H,4,7-8,11H2,1-3H3 |
| InChIKey | PCJKKCXPJCCJKU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|