C16H25NO3 — CID 110437705
N-butan-2-yl-2-(3,4-dimethoxyphenyl)-2-methylpropanamide (PubChem CID 110437705) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-butan-2-yl-2-(3,4-dimethoxyphenyl)-2-methylpropanamide.
| Compound Name | N-butan-2-yl-2-(3,4-dimethoxyphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 110437705 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-butan-2-yl-2-(3,4-dimethoxyphenyl)-2-methylpropanamide |
| SMILES | CCC(C)NC(=O)C(C)(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H25NO3/c1-7-11(2)17-15(18)16(3,4)12-8-9-13(19-5)14(10-12)20-6/h8-11H,7H2,1-6H3,(H,17,18) |
| InChIKey | FSDPPYOZHMFHQR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |