C18H27NO4 — CID 110437761
2-(3,4-dimethoxyphenyl)-N-(4-hydroxycyclohexyl)-2-methylpropanamide (PubChem CID 110437761) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(4-hydroxycyclohexyl)-2-methylpropanamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(4-hydroxycyclohexyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 110437761 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(4-hydroxycyclohexyl)-2-methylpropanamide |
| SMILES | COc1ccc(C(C)(C)C(=O)NC2CCC(O)CC2)cc1OC |
| InChI | InChI=1S/C18H27NO4/c1-18(2,12-5-10-15(22-3)16(11-12)23-4)17(21)19-13-6-8-14(20)9-7-13/h5,10-11,13-14,20H,6-9H2,1-4H3,(H,19,21) |
| InChIKey | GTZBZRYWTBOBHP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |